C16H15NO3 — CID 82156108
N-(5-formyl-2-methoxyphenyl)-2-phenylacetamide (PubChem CID 82156108) has the molecular formula C16H15NO3 and a molecular weight of 269.30 g/mol. Its IUPAC name is N-(5-formyl-2-methoxyphenyl)-2-phenylacetamide.
| Compound Name | N-(5-formyl-2-methoxyphenyl)-2-phenylacetamide |
|---|---|
| PubChem CID | 82156108 |
| Molecular Formula | C16H15NO3 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | N-(5-formyl-2-methoxyphenyl)-2-phenylacetamide |
| SMILES | COc1ccc(C=O)cc1NC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C16H15NO3/c1-20-15-8-7-13(11-18)9-14(15)17-16(19)10-12-5-3-2-4-6-12/h2-9,11H,10H2,1H3,(H,17,19) |
| InChIKey | IIRDGDPJXLDOSF-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|