C14H21NO5 — CID 144638830
tert-butyl N-(5-formyl-2-methoxyphenyl)carbamate;methanol (PubChem CID 144638830) has the molecular formula C14H21NO5 and a molecular weight of 283.32 g/mol. Its IUPAC name is tert-butyl N-(5-formyl-2-methoxyphenyl)carbamate;methanol.
| Compound Name | tert-butyl N-(5-formyl-2-methoxyphenyl)carbamate;methanol |
|---|---|
| PubChem CID | 144638830 |
| Molecular Formula | C14H21NO5 |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | tert-butyl N-(5-formyl-2-methoxyphenyl)carbamate;methanol |
| SMILES | CO.COc1ccc(C=O)cc1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H17NO4.CH4O/c1-13(2,3)18-12(16)14-10-7-9(8-15)5-6-11(10)17-4;1-2/h5-8H,1-4H3,(H,14,16);2H,1H3 |
| InChIKey | QOIUMWIPVNHRES-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|