C13H16FNO4 — CID 84808640
tert-butyl N-(2-fluoro-3-formyl-4-methoxyphenyl)carbamate (PubChem CID 84808640) has the molecular formula C13H16FNO4 and a molecular weight of 269.27 g/mol. Its IUPAC name is tert-butyl N-(2-fluoro-3-formyl-4-methoxyphenyl)carbamate.
| Compound Name | tert-butyl N-(2-fluoro-3-formyl-4-methoxyphenyl)carbamate |
|---|---|
| PubChem CID | 84808640 |
| Molecular Formula | C13H16FNO4 |
| Molecular Weight | 269.27 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | tert-butyl N-(2-fluoro-3-formyl-4-methoxyphenyl)carbamate |
| SMILES | COc1ccc(NC(=O)OC(C)(C)C)c(F)c1C=O |
| InChI | InChI=1S/C13H16FNO4/c1-13(2,3)19-12(17)15-9-5-6-10(18-4)8(7-16)11(9)14/h5-7H,1-4H3,(H,15,17) |
| InChIKey | MPKNCOFVVDOREJ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.27 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|