C22H25FN2O5 — CID 56571509
tert-butyl N-[2-[[(E)-3-(2,5-dimethoxyphenyl)prop-2-enoyl]amino]-4-fluorophenyl]carbamate (PubChem CID 56571509) has the molecular formula C22H25FN2O5 and a molecular weight of 416.45 g/mol. Its IUPAC name is tert-butyl N-[2-[[(E)-3-(2,5-dimethoxyphenyl)prop-2-enoyl]amino]-4-fluorophenyl]carbamate.
| Compound Name | tert-butyl N-[2-[[(E)-3-(2,5-dimethoxyphenyl)prop-2-enoyl]amino]-4-fluorophenyl]carbamate |
|---|---|
| PubChem CID | 56571509 |
| Molecular Formula | C22H25FN2O5 |
| Molecular Weight | 416.45 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | tert-butyl N-[2-[[(E)-3-(2,5-dimethoxyphenyl)prop-2-enoyl]amino]-4-fluorophenyl]carbamate |
| SMILES | COc1ccc(OC)c(/C=C/C(=O)Nc2cc(F)ccc2NC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C22H25FN2O5/c1-22(2,3)30-21(27)25-17-9-7-15(23)13-18(17)24-20(26)11-6-14-12-16(28-4)8-10-19(14)29-5/h6-13H,1-5H3,(H,24,26)(H,25,27)/b11-6+ |
| InChIKey | SQYYRPDPJYZRIF-IZZDOVSWSA-N |
| XLogP | 4.84 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.45 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|