C23H22ClNO3 — CID 1249675
N-(5-chloro-2,4-dimethoxyphenyl)-2-(2-phenylethyl)benzamide (PubChem CID 1249675) has the molecular formula C23H22ClNO3 and a molecular weight of 395.89 g/mol. Its IUPAC name is N-(5-chloro-2,4-dimethoxyphenyl)-2-(2-phenylethyl)benzamide.
| Compound Name | N-(5-chloro-2,4-dimethoxyphenyl)-2-(2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 1249675 |
| Molecular Formula | C23H22ClNO3 |
| Molecular Weight | 395.89 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | N-(5-chloro-2,4-dimethoxyphenyl)-2-(2-phenylethyl)benzamide |
| SMILES | COc1cc(OC)c(NC(=O)c2ccccc2CCc2ccccc2)cc1Cl |
| InChI | InChI=1S/C23H22ClNO3/c1-27-21-15-22(28-2)20(14-19(21)24)25-23(26)18-11-7-6-10-17(18)13-12-16-8-4-3-5-9-16/h3-11,14-15H,12-13H2,1-2H3,(H,25,26) |
| InChIKey | WMCCEHNNVRSKRN-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.89 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |