C16H14FNO5 — CID 707198
2-[(2-fluorobenzoyl)amino]-4,5-dimethoxybenzoic acid (PubChem CID 707198) has the molecular formula C16H14FNO5 and a molecular weight of 319.29 g/mol. Its IUPAC name is 2-[(2-fluorobenzoyl)amino]-4,5-dimethoxybenzoic acid.
| Compound Name | 2-[(2-fluorobenzoyl)amino]-4,5-dimethoxybenzoic acid |
|---|---|
| PubChem CID | 707198 |
| Molecular Formula | C16H14FNO5 |
| Molecular Weight | 319.29 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | 2-[(2-fluorobenzoyl)amino]-4,5-dimethoxybenzoic acid |
| SMILES | COc1cc(NC(=O)c2ccccc2F)c(C(=O)O)cc1OC |
| InChI | InChI=1S/C16H14FNO5/c1-22-13-7-10(16(20)21)12(8-14(13)23-2)18-15(19)9-5-3-4-6-11(9)17/h3-8H,1-2H3,(H,18,19)(H,20,21) |
| InChIKey | OYJSMKVFILXJGO-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.29 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |