2-[(2-fluorobenzoyl)amino]-4,5-dimethoxybenzoic acid

C16H14FNO5 — CID 707198

IUPAC2-[(2-fluorobenzoyl)amino]-4,5-dimethoxybenzoic acid
SMILESCOc1cc(NC(=O)c2ccccc2F)c(C(=O)O)cc1OC
InChIInChI=1S/C16H14FNO5/c1-22-13-7-10(16(20)21)12(8-14(13)23-2)18-15(19)9-5-3-4-6-11(9)17/h3-8H,1-2H3,(H,18,19)(H,20,21)
InChIKeyOYJSMKVFILXJGO-UHFFFAOYSA-N
MW319.29 g/mol
LogP2.79
Rot. Bonds5

About 2-[(2-fluorobenzoyl)amino]-4,5-dimethoxybenzoic acid

2-[(2-fluorobenzoyl)amino]-4,5-dimethoxybenzoic acid (PubChem CID 707198) has the molecular formula C16H14FNO5 and a molecular weight of 319.29 g/mol. Its IUPAC name is 2-[(2-fluorobenzoyl)amino]-4,5-dimethoxybenzoic acid.

Molecular Properties

Compound Name2-[(2-fluorobenzoyl)amino]-4,5-dimethoxybenzoic acid
PubChem CID707198
Molecular FormulaC16H14FNO5
Molecular Weight319.29 g/mol
Exact Mass319.09
IUPAC Name2-[(2-fluorobenzoyl)amino]-4,5-dimethoxybenzoic acid
SMILESCOc1cc(NC(=O)c2ccccc2F)c(C(=O)O)cc1OC
InChIInChI=1S/C16H14FNO5/c1-22-13-7-10(16(20)21)12(8-14(13)23-2)18-15(19)9-5-3-4-6-11(9)17/h3-8H,1-2H3,(H,18,19)(H,20,21)
InChIKeyOYJSMKVFILXJGO-UHFFFAOYSA-N
XLogP2.79
TPSA84.86 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500319.29
LogP ≤ 52.79
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-[(2-fluorobenzoyl)amino]-4,5-dimethoxybenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(2-fluorobenzoyl)amino]-4,5-dimethoxybenzoic acid?
The IUPAC name of 2-[(2-fluorobenzoyl)amino]-4,5-dimethoxybenzoic acid (CID 707198) is 2-[(2-fluorobenzoyl)amino]-4,5-dimethoxybenzoic acid.
What is the SMILES notation for 2-[(2-fluorobenzoyl)amino]-4,5-dimethoxybenzoic acid?
The canonical SMILES for 2-[(2-fluorobenzoyl)amino]-4,5-dimethoxybenzoic acid is COc1cc(NC(=O)c2ccccc2F)c(C(=O)O)cc1OC.
What is the InChIKey of 2-[(2-fluorobenzoyl)amino]-4,5-dimethoxybenzoic acid?
The InChIKey is OYJSMKVFILXJGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14FNO5/c1-22-13-7-10(16(20)21)12(8-14(13)23-2)18-15(19)9-5-3-4-6-11(9)17/h3-8H,1-2H3,(H,18,19)(H,20,21).
What are the key properties of 2-[(2-fluorobenzoyl)amino]-4,5-dimethoxybenzoic acid?
2-[(2-fluorobenzoyl)amino]-4,5-dimethoxybenzoic acid has a molecular weight of 319.29 g/mol, XLogP of 2.79, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-fluorobenzoyl)amino]-4,5-dimethoxybenzoic acid is sourced from PubChem (CID 707198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).