C22H26ClFN3O4- — CID 53352634
N-[2,5-dimethoxy-4-[(2-piperidin-1-ylacetyl)amino]phenyl]-2-fluorobenzamide chloride (PubChem CID 53352634) has the molecular formula C22H26ClFN3O4- and a molecular weight of 450.92 g/mol. Its IUPAC name is N-[2,5-dimethoxy-4-[(2-piperidin-1-ylacetyl)amino]phenyl]-2-fluorobenzamide chloride.
| Compound Name | N-[2,5-dimethoxy-4-[(2-piperidin-1-ylacetyl)amino]phenyl]-2-fluorobenzamide chloride |
|---|---|
| PubChem CID | 53352634 |
| Molecular Formula | C22H26ClFN3O4- |
| Molecular Weight | 450.92 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | N-[2,5-dimethoxy-4-[(2-piperidin-1-ylacetyl)amino]phenyl]-2-fluorobenzamide chloride |
| SMILES | COc1cc(NC(=O)c2ccccc2F)c(OC)cc1NC(=O)CN1CCCCC1.[Cl-] |
| InChI | InChI=1S/C22H26FN3O4.ClH/c1-29-19-13-18(25-22(28)15-8-4-5-9-16(15)23)20(30-2)12-17(19)24-21(27)14-26-10-6-3-7-11-26;/h4-5,8-9,12-13H,3,6-7,10-11,14H2,1-2H3,(H,24,27)(H,25,28);1H/p-1 |
| InChIKey | HESPTPJHVMVVAR-UHFFFAOYSA-M |
| XLogP | 0.52 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.92 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |