C22H26ClN3O4 — CID 3195251
4-chloro-N-[2,5-dimethoxy-4-[(2-piperidin-1-ylacetyl)amino]phenyl]benzamide (PubChem CID 3195251) has the molecular formula C22H26ClN3O4 and a molecular weight of 431.92 g/mol. Its IUPAC name is 4-chloro-N-[2,5-dimethoxy-4-[(2-piperidin-1-ylacetyl)amino]phenyl]benzamide.
| Compound Name | 4-chloro-N-[2,5-dimethoxy-4-[(2-piperidin-1-ylacetyl)amino]phenyl]benzamide |
|---|---|
| PubChem CID | 3195251 |
| Molecular Formula | C22H26ClN3O4 |
| Molecular Weight | 431.92 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | 4-chloro-N-[2,5-dimethoxy-4-[(2-piperidin-1-ylacetyl)amino]phenyl]benzamide |
| SMILES | COc1cc(NC(=O)c2ccc(Cl)cc2)c(OC)cc1NC(=O)CN1CCCCC1 |
| InChI | InChI=1S/C22H26ClN3O4/c1-29-19-13-18(25-22(28)15-6-8-16(23)9-7-15)20(30-2)12-17(19)24-21(27)14-26-10-4-3-5-11-26/h6-9,12-13H,3-5,10-11,14H2,1-2H3,(H,24,27)(H,25,28) |
| InChIKey | GQWBPZMJINFMCG-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.92 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |