4,5-dimethoxy-2-(propan-2-ylcarbamoylamino)benzoic acid

C13H18N2O5 — CID 28737773

IUPAC4,5-dimethoxy-2-(propan-2-ylcarbamoylamino)benzoic acid
SMILESCOc1cc(NC(=O)NC(C)C)c(C(=O)O)cc1OC
InChIInChI=1S/C13H18N2O5/c1-7(2)14-13(18)15-9-6-11(20-4)10(19-3)5-8(9)12(16)17/h5-7H,1-4H3,(H,16,17)(H2,14,15,18)
InChIKeyBLIJVBSFGOHYLA-UHFFFAOYSA-N
MW282.30 g/mol
LogP1.93
Rot. Bonds5

About 4,5-dimethoxy-2-(propan-2-ylcarbamoylamino)benzoic acid

4,5-dimethoxy-2-(propan-2-ylcarbamoylamino)benzoic acid (PubChem CID 28737773) has the molecular formula C13H18N2O5 and a molecular weight of 282.30 g/mol. Its IUPAC name is 4,5-dimethoxy-2-(propan-2-ylcarbamoylamino)benzoic acid.

Molecular Properties

Compound Name4,5-dimethoxy-2-(propan-2-ylcarbamoylamino)benzoic acid
PubChem CID28737773
Molecular FormulaC13H18N2O5
Molecular Weight282.30 g/mol
Exact Mass282.12
IUPAC Name4,5-dimethoxy-2-(propan-2-ylcarbamoylamino)benzoic acid
SMILESCOc1cc(NC(=O)NC(C)C)c(C(=O)O)cc1OC
InChIInChI=1S/C13H18N2O5/c1-7(2)14-13(18)15-9-6-11(20-4)10(19-3)5-8(9)12(16)17/h5-7H,1-4H3,(H,16,17)(H2,14,15,18)
InChIKeyBLIJVBSFGOHYLA-UHFFFAOYSA-N
XLogP1.93
TPSA96.89 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500282.30
LogP ≤ 51.93
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Analyze 4,5-dimethoxy-2-(propan-2-ylcarbamoylamino)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4,5-dimethoxy-2-(propan-2-ylcarbamoylamino)benzoic acid?
The IUPAC name of 4,5-dimethoxy-2-(propan-2-ylcarbamoylamino)benzoic acid (CID 28737773) is 4,5-dimethoxy-2-(propan-2-ylcarbamoylamino)benzoic acid.
What is the SMILES notation for 4,5-dimethoxy-2-(propan-2-ylcarbamoylamino)benzoic acid?
The canonical SMILES for 4,5-dimethoxy-2-(propan-2-ylcarbamoylamino)benzoic acid is COc1cc(NC(=O)NC(C)C)c(C(=O)O)cc1OC.
What is the InChIKey of 4,5-dimethoxy-2-(propan-2-ylcarbamoylamino)benzoic acid?
The InChIKey is BLIJVBSFGOHYLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O5/c1-7(2)14-13(18)15-9-6-11(20-4)10(19-3)5-8(9)12(16)17/h5-7H,1-4H3,(H,16,17)(H2,14,15,18).
What are the key properties of 4,5-dimethoxy-2-(propan-2-ylcarbamoylamino)benzoic acid?
4,5-dimethoxy-2-(propan-2-ylcarbamoylamino)benzoic acid has a molecular weight of 282.30 g/mol, XLogP of 1.93, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethoxy-2-(propan-2-ylcarbamoylamino)benzoic acid is sourced from PubChem (CID 28737773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).