C14H20N2O5 — CID 103870871
2-[[(2R)-2-aminopentanoyl]amino]-4,5-dimethoxybenzoic acid (PubChem CID 103870871) has the molecular formula C14H20N2O5 and a molecular weight of 296.32 g/mol. Its IUPAC name is 2-[[(2R)-2-aminopentanoyl]amino]-4,5-dimethoxybenzoic acid.
| Compound Name | 2-[[(2R)-2-aminopentanoyl]amino]-4,5-dimethoxybenzoic acid |
|---|---|
| PubChem CID | 103870871 |
| Molecular Formula | C14H20N2O5 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 2-[[(2R)-2-aminopentanoyl]amino]-4,5-dimethoxybenzoic acid |
| SMILES | CCC[C@@H](N)C(=O)Nc1cc(OC)c(OC)cc1C(=O)O |
| InChI | InChI=1S/C14H20N2O5/c1-4-5-9(15)13(17)16-10-7-12(21-3)11(20-2)6-8(10)14(18)19/h6-7,9H,4-5,15H2,1-3H3,(H,16,17)(H,18,19)/t9-/m1/s1 |
| InChIKey | PIJWAEMYYFMQSZ-SECBINFHSA-N |
| XLogP | 1.47 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |