2-[[(2R)-2-aminopentanoyl]amino]-4,5-dimethoxybenzoic acid

C14H20N2O5 — CID 103870871

IUPAC2-[[(2R)-2-aminopentanoyl]amino]-4,5-dimethoxybenzoic acid
SMILESCCC[C@@H](N)C(=O)Nc1cc(OC)c(OC)cc1C(=O)O
InChIInChI=1S/C14H20N2O5/c1-4-5-9(15)13(17)16-10-7-12(21-3)11(20-2)6-8(10)14(18)19/h6-7,9H,4-5,15H2,1-3H3,(H,16,17)(H,18,19)/t9-/m1/s1
InChIKeyPIJWAEMYYFMQSZ-SECBINFHSA-N
MW296.32 g/mol
LogP1.47
Rot. Bonds7

About 2-[[(2R)-2-aminopentanoyl]amino]-4,5-dimethoxybenzoic acid

2-[[(2R)-2-aminopentanoyl]amino]-4,5-dimethoxybenzoic acid (PubChem CID 103870871) has the molecular formula C14H20N2O5 and a molecular weight of 296.32 g/mol. Its IUPAC name is 2-[[(2R)-2-aminopentanoyl]amino]-4,5-dimethoxybenzoic acid.

Molecular Properties

Compound Name2-[[(2R)-2-aminopentanoyl]amino]-4,5-dimethoxybenzoic acid
PubChem CID103870871
Molecular FormulaC14H20N2O5
Molecular Weight296.32 g/mol
Exact Mass296.14
IUPAC Name2-[[(2R)-2-aminopentanoyl]amino]-4,5-dimethoxybenzoic acid
SMILESCCC[C@@H](N)C(=O)Nc1cc(OC)c(OC)cc1C(=O)O
InChIInChI=1S/C14H20N2O5/c1-4-5-9(15)13(17)16-10-7-12(21-3)11(20-2)6-8(10)14(18)19/h6-7,9H,4-5,15H2,1-3H3,(H,16,17)(H,18,19)/t9-/m1/s1
InChIKeyPIJWAEMYYFMQSZ-SECBINFHSA-N
XLogP1.47
TPSA110.88 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds7
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500296.32
LogP ≤ 51.47
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Analyze 2-[[(2R)-2-aminopentanoyl]amino]-4,5-dimethoxybenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[[(2R)-2-aminopentanoyl]amino]-4,5-dimethoxybenzoic acid?
The IUPAC name of 2-[[(2R)-2-aminopentanoyl]amino]-4,5-dimethoxybenzoic acid (CID 103870871) is 2-[[(2R)-2-aminopentanoyl]amino]-4,5-dimethoxybenzoic acid.
What is the SMILES notation for 2-[[(2R)-2-aminopentanoyl]amino]-4,5-dimethoxybenzoic acid?
The canonical SMILES for 2-[[(2R)-2-aminopentanoyl]amino]-4,5-dimethoxybenzoic acid is CCC[C@@H](N)C(=O)Nc1cc(OC)c(OC)cc1C(=O)O.
What is the InChIKey of 2-[[(2R)-2-aminopentanoyl]amino]-4,5-dimethoxybenzoic acid?
The InChIKey is PIJWAEMYYFMQSZ-SECBINFHSA-N. The full InChI is InChI=1S/C14H20N2O5/c1-4-5-9(15)13(17)16-10-7-12(21-3)11(20-2)6-8(10)14(18)19/h6-7,9H,4-5,15H2,1-3H3,(H,16,17)(H,18,19)/t9-/m1/s1.
What are the key properties of 2-[[(2R)-2-aminopentanoyl]amino]-4,5-dimethoxybenzoic acid?
2-[[(2R)-2-aminopentanoyl]amino]-4,5-dimethoxybenzoic acid has a molecular weight of 296.32 g/mol, XLogP of 1.47, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(2R)-2-aminopentanoyl]amino]-4,5-dimethoxybenzoic acid is sourced from PubChem (CID 103870871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).