C13H19ClN2O3 — CID 107567961
(2S)-2-amino-N-(4-chloro-2,5-dimethoxyphenyl)pentanamide (PubChem CID 107567961) has the molecular formula C13H19ClN2O3 and a molecular weight of 286.76 g/mol. Its IUPAC name is (2S)-2-amino-N-(4-chloro-2,5-dimethoxyphenyl)pentanamide.
| Compound Name | (2S)-2-amino-N-(4-chloro-2,5-dimethoxyphenyl)pentanamide |
|---|---|
| PubChem CID | 107567961 |
| Molecular Formula | C13H19ClN2O3 |
| Molecular Weight | 286.76 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | (2S)-2-amino-N-(4-chloro-2,5-dimethoxyphenyl)pentanamide |
| SMILES | CCC[C@H](N)C(=O)Nc1cc(OC)c(Cl)cc1OC |
| InChI | InChI=1S/C13H19ClN2O3/c1-4-5-9(15)13(17)16-10-7-11(18-2)8(14)6-12(10)19-3/h6-7,9H,4-5,15H2,1-3H3,(H,16,17)/t9-/m0/s1 |
| InChIKey | BPNVHXBIHYKTKY-VIFPVBQESA-N |
| XLogP | 2.42 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.76 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |