C13H17ClN2O5 — CID 64895589
4-amino-5-(5-chloro-2,4-dimethoxyanilino)-5-oxopentanoic acid (PubChem CID 64895589) has the molecular formula C13H17ClN2O5 and a molecular weight of 316.74 g/mol. Its IUPAC name is 4-amino-5-(5-chloro-2,4-dimethoxyanilino)-5-oxopentanoic acid.
| Compound Name | 4-amino-5-(5-chloro-2,4-dimethoxyanilino)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 64895589 |
| Molecular Formula | C13H17ClN2O5 |
| Molecular Weight | 316.74 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | 4-amino-5-(5-chloro-2,4-dimethoxyanilino)-5-oxopentanoic acid |
| SMILES | COc1cc(OC)c(NC(=O)C(N)CCC(=O)O)cc1Cl |
| InChI | InChI=1S/C13H17ClN2O5/c1-20-10-6-11(21-2)9(5-7(10)14)16-13(19)8(15)3-4-12(17)18/h5-6,8H,3-4,15H2,1-2H3,(H,16,19)(H,17,18) |
| InChIKey | IJFVFFJAPLFPIC-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.74 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |