C13H15ClN2O5 — CID 64896803
4-amino-5-(2-chloro-5-methoxycarbonylanilino)-5-oxopentanoic acid (PubChem CID 64896803) has the molecular formula C13H15ClN2O5 and a molecular weight of 314.73 g/mol. Its IUPAC name is 4-amino-5-(2-chloro-5-methoxycarbonylanilino)-5-oxopentanoic acid.
| Compound Name | 4-amino-5-(2-chloro-5-methoxycarbonylanilino)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 64896803 |
| Molecular Formula | C13H15ClN2O5 |
| Molecular Weight | 314.73 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 4-amino-5-(2-chloro-5-methoxycarbonylanilino)-5-oxopentanoic acid |
| SMILES | COC(=O)c1ccc(Cl)c(NC(=O)C(N)CCC(=O)O)c1 |
| InChI | InChI=1S/C13H15ClN2O5/c1-21-13(20)7-2-3-8(14)10(6-7)16-12(19)9(15)4-5-11(17)18/h2-3,6,9H,4-5,15H2,1H3,(H,16,19)(H,17,18) |
| InChIKey | WUVQQTKEMXJSKN-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.73 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |