C12H17ClN2O4 — CID 81081918
2-amino-N-(4-chloro-2,5-dimethoxyphenyl)-3-methoxypropanamide (PubChem CID 81081918) has the molecular formula C12H17ClN2O4 and a molecular weight of 288.73 g/mol. Its IUPAC name is 2-amino-N-(4-chloro-2,5-dimethoxyphenyl)-3-methoxypropanamide.
| Compound Name | 2-amino-N-(4-chloro-2,5-dimethoxyphenyl)-3-methoxypropanamide |
|---|---|
| PubChem CID | 81081918 |
| Molecular Formula | C12H17ClN2O4 |
| Molecular Weight | 288.73 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 2-amino-N-(4-chloro-2,5-dimethoxyphenyl)-3-methoxypropanamide |
| SMILES | COCC(N)C(=O)Nc1cc(OC)c(Cl)cc1OC |
| InChI | InChI=1S/C12H17ClN2O4/c1-17-6-8(14)12(16)15-9-5-10(18-2)7(13)4-11(9)19-3/h4-5,8H,6,14H2,1-3H3,(H,15,16) |
| InChIKey | DRISMPGZMYPHED-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.73 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |