C11H15ClN2O4 — CID 110676079
1-(4-chloro-2,5-dimethoxyphenyl)-3-(methoxymethyl)urea (PubChem CID 110676079) has the molecular formula C11H15ClN2O4 and a molecular weight of 274.70 g/mol. Its IUPAC name is 1-(4-chloro-2,5-dimethoxyphenyl)-3-(methoxymethyl)urea.
| Compound Name | 1-(4-chloro-2,5-dimethoxyphenyl)-3-(methoxymethyl)urea |
|---|---|
| PubChem CID | 110676079 |
| Molecular Formula | C11H15ClN2O4 |
| Molecular Weight | 274.70 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | 1-(4-chloro-2,5-dimethoxyphenyl)-3-(methoxymethyl)urea |
| SMILES | COCNC(=O)Nc1cc(OC)c(Cl)cc1OC |
| InChI | InChI=1S/C11H15ClN2O4/c1-16-6-13-11(15)14-8-5-9(17-2)7(12)4-10(8)18-3/h4-5H,6H2,1-3H3,(H2,13,14,15) |
| InChIKey | ZOIQTYNVYQGWDT-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.70 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|