C19H21ClN2O3 — CID 113213943
1-(4-chloro-2,5-dimethoxyphenyl)-3-[(1-phenylcyclopropyl)methyl]urea (PubChem CID 113213943) has the molecular formula C19H21ClN2O3 and a molecular weight of 360.84 g/mol. Its IUPAC name is 1-(4-chloro-2,5-dimethoxyphenyl)-3-[(1-phenylcyclopropyl)methyl]urea.
| Compound Name | 1-(4-chloro-2,5-dimethoxyphenyl)-3-[(1-phenylcyclopropyl)methyl]urea |
|---|---|
| PubChem CID | 113213943 |
| Molecular Formula | C19H21ClN2O3 |
| Molecular Weight | 360.84 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | 1-(4-chloro-2,5-dimethoxyphenyl)-3-[(1-phenylcyclopropyl)methyl]urea |
| SMILES | COc1cc(NC(=O)NCC2(c3ccccc3)CC2)c(OC)cc1Cl |
| InChI | InChI=1S/C19H21ClN2O3/c1-24-16-11-15(17(25-2)10-14(16)20)22-18(23)21-12-19(8-9-19)13-6-4-3-5-7-13/h3-7,10-11H,8-9,12H2,1-2H3,(H2,21,22,23) |
| InChIKey | RGRAHGWJKWMHHO-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.84 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |