C12H16ClNO4 — CID 117436981
4-amino-4-(4-chloro-2,5-dimethoxyphenyl)butanoic acid (PubChem CID 117436981) has the molecular formula C12H16ClNO4 and a molecular weight of 273.72 g/mol. Its IUPAC name is 4-amino-4-(4-chloro-2,5-dimethoxyphenyl)butanoic acid.
| Compound Name | 4-amino-4-(4-chloro-2,5-dimethoxyphenyl)butanoic acid |
|---|---|
| PubChem CID | 117436981 |
| Molecular Formula | C12H16ClNO4 |
| Molecular Weight | 273.72 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 4-amino-4-(4-chloro-2,5-dimethoxyphenyl)butanoic acid |
| SMILES | COc1cc(C(N)CCC(=O)O)c(OC)cc1Cl |
| InChI | InChI=1S/C12H16ClNO4/c1-17-10-6-8(13)11(18-2)5-7(10)9(14)3-4-12(15)16/h5-6,9H,3-4,14H2,1-2H3,(H,15,16) |
| InChIKey | QECFPMLVGNITCF-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.72 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |