C13H18ClNO4 — CID 117464407
4-amino-4-(5-chloro-2,3-dimethoxy-6-methylphenyl)butanoic acid (PubChem CID 117464407) has the molecular formula C13H18ClNO4 and a molecular weight of 287.74 g/mol. Its IUPAC name is 4-amino-4-(5-chloro-2,3-dimethoxy-6-methylphenyl)butanoic acid.
| Compound Name | 4-amino-4-(5-chloro-2,3-dimethoxy-6-methylphenyl)butanoic acid |
|---|---|
| PubChem CID | 117464407 |
| Molecular Formula | C13H18ClNO4 |
| Molecular Weight | 287.74 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 4-amino-4-(5-chloro-2,3-dimethoxy-6-methylphenyl)butanoic acid |
| SMILES | COc1cc(Cl)c(C)c(C(N)CCC(=O)O)c1OC |
| InChI | InChI=1S/C13H18ClNO4/c1-7-8(14)6-10(18-2)13(19-3)12(7)9(15)4-5-11(16)17/h6,9H,4-5,15H2,1-3H3,(H,16,17) |
| InChIKey | YUZDQQVOPFUAIN-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.74 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |