C20H25N3O4 — CID 119265950
N-[4-(2-aminopentanoylamino)-2,5-dimethoxyphenyl]benzamide (PubChem CID 119265950) has the molecular formula C20H25N3O4 and a molecular weight of 371.44 g/mol. Its IUPAC name is N-[4-(2-aminopentanoylamino)-2,5-dimethoxyphenyl]benzamide.
| Compound Name | N-[4-(2-aminopentanoylamino)-2,5-dimethoxyphenyl]benzamide |
|---|---|
| PubChem CID | 119265950 |
| Molecular Formula | C20H25N3O4 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | N-[4-(2-aminopentanoylamino)-2,5-dimethoxyphenyl]benzamide |
| SMILES | CCCC(N)C(=O)Nc1cc(OC)c(NC(=O)c2ccccc2)cc1OC |
| InChI | InChI=1S/C20H25N3O4/c1-4-8-14(21)20(25)23-16-12-17(26-2)15(11-18(16)27-3)22-19(24)13-9-6-5-7-10-13/h5-7,9-12,14H,4,8,21H2,1-3H3,(H,22,24)(H,23,25) |
| InChIKey | AJCVUVCRZJVOCW-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |