C26H28N2O5 — CID 53266069
N-[4-[2-(4-ethylphenoxy)propanoylamino]-2,5-dimethoxyphenyl]benzamide (PubChem CID 53266069) has the molecular formula C26H28N2O5 and a molecular weight of 448.52 g/mol. Its IUPAC name is N-[4-[2-(4-ethylphenoxy)propanoylamino]-2,5-dimethoxyphenyl]benzamide.
| Compound Name | N-[4-[2-(4-ethylphenoxy)propanoylamino]-2,5-dimethoxyphenyl]benzamide |
|---|---|
| PubChem CID | 53266069 |
| Molecular Formula | C26H28N2O5 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | N-[4-[2-(4-ethylphenoxy)propanoylamino]-2,5-dimethoxyphenyl]benzamide |
| SMILES | CCc1ccc(OC(C)C(=O)Nc2cc(OC)c(NC(=O)c3ccccc3)cc2OC)cc1 |
| InChI | InChI=1S/C26H28N2O5/c1-5-18-11-13-20(14-12-18)33-17(2)25(29)27-21-15-24(32-4)22(16-23(21)31-3)28-26(30)19-9-7-6-8-10-19/h6-17H,5H2,1-4H3,(H,27,29)(H,28,30) |
| InChIKey | HYMOWGTWDWBKOE-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |