C22H30ClN3O4 — CID 119265926
N-[4-(2-aminopentanoylamino)-2,5-diethoxyphenyl]benzamide;hydrochloride (PubChem CID 119265926) has the molecular formula C22H30ClN3O4 and a molecular weight of 435.95 g/mol. Its IUPAC name is N-[4-(2-aminopentanoylamino)-2,5-diethoxyphenyl]benzamide;hydrochloride.
| Compound Name | N-[4-(2-aminopentanoylamino)-2,5-diethoxyphenyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 119265926 |
| Molecular Formula | C22H30ClN3O4 |
| Molecular Weight | 435.95 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | N-[4-(2-aminopentanoylamino)-2,5-diethoxyphenyl]benzamide;hydrochloride |
| SMILES | CCCC(N)C(=O)Nc1cc(OCC)c(NC(=O)c2ccccc2)cc1OCC.Cl |
| InChI | InChI=1S/C22H29N3O4.ClH/c1-4-10-16(23)22(27)25-18-14-19(28-5-2)17(13-20(18)29-6-3)24-21(26)15-11-8-7-9-12-15;/h7-9,11-14,16H,4-6,10,23H2,1-3H3,(H,24,26)(H,25,27);1H |
| InChIKey | WCAWOONQSJXXEX-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.95 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |