C16H26ClN3O3 — CID 119342429
3-(2-aminopentanoylamino)-4-ethoxy-N,N-dimethylbenzamide;hydrochloride (PubChem CID 119342429) has the molecular formula C16H26ClN3O3 and a molecular weight of 343.86 g/mol. Its IUPAC name is 3-(2-aminopentanoylamino)-4-ethoxy-N,N-dimethylbenzamide;hydrochloride.
| Compound Name | 3-(2-aminopentanoylamino)-4-ethoxy-N,N-dimethylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 119342429 |
| Molecular Formula | C16H26ClN3O3 |
| Molecular Weight | 343.86 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | 3-(2-aminopentanoylamino)-4-ethoxy-N,N-dimethylbenzamide;hydrochloride |
| SMILES | CCCC(N)C(=O)Nc1cc(C(=O)N(C)C)ccc1OCC.Cl |
| InChI | InChI=1S/C16H25N3O3.ClH/c1-5-7-12(17)15(20)18-13-10-11(16(21)19(3)4)8-9-14(13)22-6-2;/h8-10,12H,5-7,17H2,1-4H3,(H,18,20);1H |
| InChIKey | ZTNMSGLRTYDELQ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.86 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |