C25H23F3N2O4 — CID 2128081
N-(4-benzamido-2,5-diethoxyphenyl)-3-(trifluoromethyl)benzamide (PubChem CID 2128081) has the molecular formula C25H23F3N2O4 and a molecular weight of 472.46 g/mol. Its IUPAC name is N-(4-benzamido-2,5-diethoxyphenyl)-3-(trifluoromethyl)benzamide.
| Compound Name | N-(4-benzamido-2,5-diethoxyphenyl)-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 2128081 |
| Molecular Formula | C25H23F3N2O4 |
| Molecular Weight | 472.46 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | N-(4-benzamido-2,5-diethoxyphenyl)-3-(trifluoromethyl)benzamide |
| SMILES | CCOc1cc(NC(=O)c2cccc(C(F)(F)F)c2)c(OCC)cc1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C25H23F3N2O4/c1-3-33-21-15-20(30-24(32)17-11-8-12-18(13-17)25(26,27)28)22(34-4-2)14-19(21)29-23(31)16-9-6-5-7-10-16/h5-15H,3-4H2,1-2H3,(H,29,31)(H,30,32) |
| InChIKey | BYXPCJKXOANSAX-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.46 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |