C25H22F4N2O4 — CID 60594400
N-(4-benzamido-2,5-diethoxyphenyl)-4-fluoro-3-(trifluoromethyl)benzamide (PubChem CID 60594400) has the molecular formula C25H22F4N2O4 and a molecular weight of 490.45 g/mol. Its IUPAC name is N-(4-benzamido-2,5-diethoxyphenyl)-4-fluoro-3-(trifluoromethyl)benzamide.
| Compound Name | N-(4-benzamido-2,5-diethoxyphenyl)-4-fluoro-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 60594400 |
| Molecular Formula | C25H22F4N2O4 |
| Molecular Weight | 490.45 g/mol |
| Exact Mass | 490.15 |
| IUPAC Name | N-(4-benzamido-2,5-diethoxyphenyl)-4-fluoro-3-(trifluoromethyl)benzamide |
| SMILES | CCOc1cc(NC(=O)c2ccc(F)c(C(F)(F)F)c2)c(OCC)cc1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C25H22F4N2O4/c1-3-34-21-14-20(31-24(33)16-10-11-18(26)17(12-16)25(27,28)29)22(35-4-2)13-19(21)30-23(32)15-8-6-5-7-9-15/h5-14H,3-4H2,1-2H3,(H,30,32)(H,31,33) |
| InChIKey | SZUXVLAOKFBLGW-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.45 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |