C21H27N3O4 — CID 1051988
N-[2,5-diethoxy-4-(propan-2-ylcarbamoylamino)phenyl]benzamide (PubChem CID 1051988) has the molecular formula C21H27N3O4 and a molecular weight of 385.46 g/mol. Its IUPAC name is N-[2,5-diethoxy-4-(propan-2-ylcarbamoylamino)phenyl]benzamide.
| Compound Name | N-[2,5-diethoxy-4-(propan-2-ylcarbamoylamino)phenyl]benzamide |
|---|---|
| PubChem CID | 1051988 |
| Molecular Formula | C21H27N3O4 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | N-[2,5-diethoxy-4-(propan-2-ylcarbamoylamino)phenyl]benzamide |
| SMILES | CCOc1cc(NC(=O)c2ccccc2)c(OCC)cc1NC(=O)NC(C)C |
| InChI | InChI=1S/C21H27N3O4/c1-5-27-18-13-17(24-21(26)22-14(3)4)19(28-6-2)12-16(18)23-20(25)15-10-8-7-9-11-15/h7-14H,5-6H2,1-4H3,(H,23,25)(H2,22,24,26) |
| InChIKey | KVXNPGKTBRVTMR-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |