C25H24F3N3O4 — CID 5163768
N-[2,5-diethoxy-4-[[3-(trifluoromethyl)phenyl]carbamoylamino]phenyl]benzamide (PubChem CID 5163768) has the molecular formula C25H24F3N3O4 and a molecular weight of 487.48 g/mol. Its IUPAC name is N-[2,5-diethoxy-4-[[3-(trifluoromethyl)phenyl]carbamoylamino]phenyl]benzamide.
| Compound Name | N-[2,5-diethoxy-4-[[3-(trifluoromethyl)phenyl]carbamoylamino]phenyl]benzamide |
|---|---|
| PubChem CID | 5163768 |
| Molecular Formula | C25H24F3N3O4 |
| Molecular Weight | 487.48 g/mol |
| Exact Mass | 487.17 |
| IUPAC Name | N-[2,5-diethoxy-4-[[3-(trifluoromethyl)phenyl]carbamoylamino]phenyl]benzamide |
| SMILES | CCOc1cc(NC(=O)c2ccccc2)c(OCC)cc1NC(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H24F3N3O4/c1-3-34-21-15-20(31-24(33)29-18-12-8-11-17(13-18)25(26,27)28)22(35-4-2)14-19(21)30-23(32)16-9-6-5-7-10-16/h5-15H,3-4H2,1-2H3,(H,30,32)(H2,29,31,33) |
| InChIKey | JSAOKXWTYLLXCT-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.48 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |