C16H13F3N2O3 — CID 10268726
2-[2-[[3-(trifluoromethyl)phenyl]carbamoylamino]phenyl]acetic acid (PubChem CID 10268726) has the molecular formula C16H13F3N2O3 and a molecular weight of 338.29 g/mol. Its IUPAC name is 2-[2-[[3-(trifluoromethyl)phenyl]carbamoylamino]phenyl]acetic acid.
| Compound Name | 2-[2-[[3-(trifluoromethyl)phenyl]carbamoylamino]phenyl]acetic acid |
|---|---|
| PubChem CID | 10268726 |
| Molecular Formula | C16H13F3N2O3 |
| Molecular Weight | 338.29 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 2-[2-[[3-(trifluoromethyl)phenyl]carbamoylamino]phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccccc1NC(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H13F3N2O3/c17-16(18,19)11-5-3-6-12(9-11)20-15(24)21-13-7-2-1-4-10(13)8-14(22)23/h1-7,9H,8H2,(H,22,23)(H2,20,21,24) |
| InChIKey | AAYUIPSZZFLQFE-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.29 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |