C13H17F3N2O2 — CID 60586531
1-[2-ethoxy-5-(trifluoromethyl)phenyl]-3-propan-2-ylurea (PubChem CID 60586531) has the molecular formula C13H17F3N2O2 and a molecular weight of 290.29 g/mol. Its IUPAC name is 1-[2-ethoxy-5-(trifluoromethyl)phenyl]-3-propan-2-ylurea.
| Compound Name | 1-[2-ethoxy-5-(trifluoromethyl)phenyl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 60586531 |
| Molecular Formula | C13H17F3N2O2 |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 1-[2-ethoxy-5-(trifluoromethyl)phenyl]-3-propan-2-ylurea |
| SMILES | CCOc1ccc(C(F)(F)F)cc1NC(=O)NC(C)C |
| InChI | InChI=1S/C13H17F3N2O2/c1-4-20-11-6-5-9(13(14,15)16)7-10(11)18-12(19)17-8(2)3/h5-8H,4H2,1-3H3,(H2,17,18,19) |
| InChIKey | GDLHAHSRTXASCY-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |