C25H26N2O4 — CID 1051986
N-(4-benzamido-2,5-diethoxyphenyl)-2-methylbenzamide (PubChem CID 1051986) has the molecular formula C25H26N2O4 and a molecular weight of 418.49 g/mol. Its IUPAC name is N-(4-benzamido-2,5-diethoxyphenyl)-2-methylbenzamide.
| Compound Name | N-(4-benzamido-2,5-diethoxyphenyl)-2-methylbenzamide |
|---|---|
| PubChem CID | 1051986 |
| Molecular Formula | C25H26N2O4 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | N-(4-benzamido-2,5-diethoxyphenyl)-2-methylbenzamide |
| SMILES | CCOc1cc(NC(=O)c2ccccc2C)c(OCC)cc1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C25H26N2O4/c1-4-30-22-16-21(27-25(29)19-14-10-9-11-17(19)3)23(31-5-2)15-20(22)26-24(28)18-12-7-6-8-13-18/h6-16H,4-5H2,1-3H3,(H,26,28)(H,27,29) |
| InChIKey | SPDZPDKYDYWFST-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |