C28H26FN3O4 — CID 46686426
N-(4-benzamido-2,5-diethoxyphenyl)-7-fluoro-2-methylquinoline-4-carboxamide (PubChem CID 46686426) has the molecular formula C28H26FN3O4 and a molecular weight of 487.53 g/mol. Its IUPAC name is N-(4-benzamido-2,5-diethoxyphenyl)-7-fluoro-2-methylquinoline-4-carboxamide.
| Compound Name | N-(4-benzamido-2,5-diethoxyphenyl)-7-fluoro-2-methylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 46686426 |
| Molecular Formula | C28H26FN3O4 |
| Molecular Weight | 487.53 g/mol |
| Exact Mass | 487.19 |
| IUPAC Name | N-(4-benzamido-2,5-diethoxyphenyl)-7-fluoro-2-methylquinoline-4-carboxamide |
| SMILES | CCOc1cc(NC(=O)c2cc(C)nc3cc(F)ccc23)c(OCC)cc1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C28H26FN3O4/c1-4-35-25-16-24(26(36-5-2)15-23(25)31-27(33)18-9-7-6-8-10-18)32-28(34)21-13-17(3)30-22-14-19(29)11-12-20(21)22/h6-16H,4-5H2,1-3H3,(H,31,33)(H,32,34) |
| InChIKey | MMSUFALTVXDOTL-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.53 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |