C23H26FN3O4S — CID 46686472
N-[5-(diethylsulfamoyl)-2-ethoxyphenyl]-7-fluoro-2-methylquinoline-4-carboxamide (PubChem CID 46686472) has the molecular formula C23H26FN3O4S and a molecular weight of 459.54 g/mol. Its IUPAC name is N-[5-(diethylsulfamoyl)-2-ethoxyphenyl]-7-fluoro-2-methylquinoline-4-carboxamide.
| Compound Name | N-[5-(diethylsulfamoyl)-2-ethoxyphenyl]-7-fluoro-2-methylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 46686472 |
| Molecular Formula | C23H26FN3O4S |
| Molecular Weight | 459.54 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | N-[5-(diethylsulfamoyl)-2-ethoxyphenyl]-7-fluoro-2-methylquinoline-4-carboxamide |
| SMILES | CCOc1ccc(S(=O)(=O)N(CC)CC)cc1NC(=O)c1cc(C)nc2cc(F)ccc12 |
| InChI | InChI=1S/C23H26FN3O4S/c1-5-27(6-2)32(29,30)17-9-11-22(31-7-3)21(14-17)26-23(28)19-12-15(4)25-20-13-16(24)8-10-18(19)20/h8-14H,5-7H2,1-4H3,(H,26,28) |
| InChIKey | LJAMZDWQEFJOQG-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.54 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |