C25H35N3O4 — CID 108795354
N-[4-[3-[butyl(methyl)amino]propanoylamino]-2,5-diethoxyphenyl]benzamide (PubChem CID 108795354) has the molecular formula C25H35N3O4 and a molecular weight of 441.57 g/mol. Its IUPAC name is N-[4-[3-[butyl(methyl)amino]propanoylamino]-2,5-diethoxyphenyl]benzamide.
| Compound Name | N-[4-[3-[butyl(methyl)amino]propanoylamino]-2,5-diethoxyphenyl]benzamide |
|---|---|
| PubChem CID | 108795354 |
| Molecular Formula | C25H35N3O4 |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.26 |
| IUPAC Name | N-[4-[3-[butyl(methyl)amino]propanoylamino]-2,5-diethoxyphenyl]benzamide |
| SMILES | CCCCN(C)CCC(=O)Nc1cc(OCC)c(NC(=O)c2ccccc2)cc1OCC |
| InChI | InChI=1S/C25H35N3O4/c1-5-8-15-28(4)16-14-24(29)26-20-17-23(32-7-3)21(18-22(20)31-6-2)27-25(30)19-12-10-9-11-13-19/h9-13,17-18H,5-8,14-16H2,1-4H3,(H,26,29)(H,27,30) |
| InChIKey | PZVRMYHYBHFQLM-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |