C12H13ClN2O6 — CID 64896328
4-[(2-amino-3-carboxypropanoyl)amino]-5-chloro-2-methoxybenzoic acid (PubChem CID 64896328) has the molecular formula C12H13ClN2O6 and a molecular weight of 316.70 g/mol. Its IUPAC name is 4-[(2-amino-3-carboxypropanoyl)amino]-5-chloro-2-methoxybenzoic acid.
| Compound Name | 4-[(2-amino-3-carboxypropanoyl)amino]-5-chloro-2-methoxybenzoic acid |
|---|---|
| PubChem CID | 64896328 |
| Molecular Formula | C12H13ClN2O6 |
| Molecular Weight | 316.70 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | 4-[(2-amino-3-carboxypropanoyl)amino]-5-chloro-2-methoxybenzoic acid |
| SMILES | COc1cc(NC(=O)C(N)CC(=O)O)c(Cl)cc1C(=O)O |
| InChI | InChI=1S/C12H13ClN2O6/c1-21-9-4-8(6(13)2-5(9)12(19)20)15-11(18)7(14)3-10(16)17/h2,4,7H,3,14H2,1H3,(H,15,18)(H,16,17)(H,19,20) |
| InChIKey | AMTVMEGVMNLNQG-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 138.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.70 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |