C13H17ClN2O4S — CID 61162190
4-[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]-5-chloro-2-methoxybenzoic acid (PubChem CID 61162190) has the molecular formula C13H17ClN2O4S and a molecular weight of 332.81 g/mol. Its IUPAC name is 4-[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]-5-chloro-2-methoxybenzoic acid.
| Compound Name | 4-[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]-5-chloro-2-methoxybenzoic acid |
|---|---|
| PubChem CID | 61162190 |
| Molecular Formula | C13H17ClN2O4S |
| Molecular Weight | 332.81 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | 4-[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]-5-chloro-2-methoxybenzoic acid |
| SMILES | COc1cc(NC(=O)[C@@H](N)CCSC)c(Cl)cc1C(=O)O |
| InChI | InChI=1S/C13H17ClN2O4S/c1-20-11-6-10(8(14)5-7(11)13(18)19)16-12(17)9(15)3-4-21-2/h5-6,9H,3-4,15H2,1-2H3,(H,16,17)(H,18,19)/t9-/m0/s1 |
| InChIKey | XBIZZKVAZHXXNQ-VIFPVBQESA-N |
| XLogP | 2.07 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.81 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |