C12H17N3O5 — CID 83018527
2-(dimethylaminocarbamoylamino)-4,5-dimethoxybenzoic acid (PubChem CID 83018527) has the molecular formula C12H17N3O5 and a molecular weight of 283.28 g/mol. Its IUPAC name is 2-(dimethylaminocarbamoylamino)-4,5-dimethoxybenzoic acid.
| Compound Name | 2-(dimethylaminocarbamoylamino)-4,5-dimethoxybenzoic acid |
|---|---|
| PubChem CID | 83018527 |
| Molecular Formula | C12H17N3O5 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 2-(dimethylaminocarbamoylamino)-4,5-dimethoxybenzoic acid |
| SMILES | COc1cc(NC(=O)NN(C)C)c(C(=O)O)cc1OC |
| InChI | InChI=1S/C12H17N3O5/c1-15(2)14-12(18)13-8-6-10(20-4)9(19-3)5-7(8)11(16)17/h5-6H,1-4H3,(H,16,17)(H2,13,14,18) |
| InChIKey | KDGDITXDPQFNDT-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|