C17H15F3N2O5 — CID 10110546
4,5-dimethoxy-2-[[3-(trifluoromethyl)phenyl]carbamoylamino]benzoic acid (PubChem CID 10110546) has the molecular formula C17H15F3N2O5 and a molecular weight of 384.31 g/mol. Its IUPAC name is 4,5-dimethoxy-2-[[3-(trifluoromethyl)phenyl]carbamoylamino]benzoic acid.
| Compound Name | 4,5-dimethoxy-2-[[3-(trifluoromethyl)phenyl]carbamoylamino]benzoic acid |
|---|---|
| PubChem CID | 10110546 |
| Molecular Formula | C17H15F3N2O5 |
| Molecular Weight | 384.31 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | 4,5-dimethoxy-2-[[3-(trifluoromethyl)phenyl]carbamoylamino]benzoic acid |
| SMILES | COc1cc(NC(=O)Nc2cccc(C(F)(F)F)c2)c(C(=O)O)cc1OC |
| InChI | InChI=1S/C17H15F3N2O5/c1-26-13-7-11(15(23)24)12(8-14(13)27-2)22-16(25)21-10-5-3-4-9(6-10)17(18,19)20/h3-8H,1-2H3,(H,23,24)(H2,21,22,25) |
| InChIKey | GBIZDGBEYXSEAC-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.31 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |