C15H14F3N3O3 — CID 2741388
1-(2,6-dimethoxy-3-pyridinyl)-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 2741388) has the molecular formula C15H14F3N3O3 and a molecular weight of 341.29 g/mol. Its IUPAC name is 1-(2,6-dimethoxy-3-pyridinyl)-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-(2,6-dimethoxy-3-pyridinyl)-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 2741388 |
| Molecular Formula | C15H14F3N3O3 |
| Molecular Weight | 341.29 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | 1-(2,6-dimethoxy-3-pyridinyl)-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | COc1ccc(NC(=O)Nc2cccc(C(F)(F)F)c2)c(OC)n1 |
| InChI | InChI=1S/C15H14F3N3O3/c1-23-12-7-6-11(13(21-12)24-2)20-14(22)19-10-5-3-4-9(8-10)15(16,17)18/h3-8H,1-2H3,(H2,19,20,22) |
| InChIKey | QBWOZTNPCCYEFB-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.29 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |