C35H29F6N5O5 — CID 158739006
1-(4-anilino-2-hydroxyphenyl)-3-[3-(trifluoromethyl)phenyl]urea;1-(2-hydroxy-5-methoxyphenyl)-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 158739006) has the molecular formula C35H29F6N5O5 and a molecular weight of 713.64 g/mol. Its IUPAC name is 1-(4-anilino-2-hydroxyphenyl)-3-[3-(trifluoromethyl)phenyl]urea;1-(2-hydroxy-5-methoxyphenyl)-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-(4-anilino-2-hydroxyphenyl)-3-[3-(trifluoromethyl)phenyl]urea;1-(2-hydroxy-5-methoxyphenyl)-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 158739006 |
| Molecular Formula | C35H29F6N5O5 |
| Molecular Weight | 713.64 g/mol |
| Exact Mass | 713.21 |
| IUPAC Name | 1-(4-anilino-2-hydroxyphenyl)-3-[3-(trifluoromethyl)phenyl]urea;1-(2-hydroxy-5-methoxyphenyl)-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | COc1ccc(O)c(NC(=O)Nc2cccc(C(F)(F)F)c2)c1.O=C(Nc1cccc(C(F)(F)F)c1)Nc1ccc(Nc2ccccc2)cc1O |
| InChI | InChI=1S/C20H16F3N3O2.C15H13F3N2O3/c21-20(22,23)13-5-4-8-15(11-13)25-19(28)26-17-10-9-16(12-18(17)27)24-14-6-2-1-3-7-14;1-23-11-5-6-13(21)12(8-11)20-14(22)19-10-4-2-3-9(7-10)15(16,17)18/h1-12,24,27H,(H2,25,26,28);2-8,21H,1H3,(H2,19,20,22) |
| InChIKey | IMAWBZXFQIXJOV-UHFFFAOYSA-N |
| XLogP | 9.86 |
| TPSA | 143.98 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.64 |
| LogP ≤ 5 | 9.86 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|