C14H12Cl2N2O3 — CID 139743679
1-(3,4-dichlorophenyl)-3-(2-hydroxy-5-methoxyphenyl)urea (PubChem CID 139743679) has the molecular formula C14H12Cl2N2O3 and a molecular weight of 327.17 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-(2-hydroxy-5-methoxyphenyl)urea.
| Compound Name | 1-(3,4-dichlorophenyl)-3-(2-hydroxy-5-methoxyphenyl)urea |
|---|---|
| PubChem CID | 139743679 |
| Molecular Formula | C14H12Cl2N2O3 |
| Molecular Weight | 327.17 g/mol |
| Exact Mass | 326.02 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-(2-hydroxy-5-methoxyphenyl)urea |
| SMILES | COc1ccc(O)c(NC(=O)Nc2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C14H12Cl2N2O3/c1-21-9-3-5-13(19)12(7-9)18-14(20)17-8-2-4-10(15)11(16)6-8/h2-7,19H,1H3,(H2,17,18,20) |
| InChIKey | OYIBOUAJNBIIAP-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.17 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|