C22H17Cl2N5O2 — CID 44569611
1-(3,4-dichlorophenyl)-3-[4-(4-methoxyanilino)quinazolin-6-yl]urea (PubChem CID 44569611) has the molecular formula C22H17Cl2N5O2 and a molecular weight of 454.32 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-[4-(4-methoxyanilino)quinazolin-6-yl]urea.
| Compound Name | 1-(3,4-dichlorophenyl)-3-[4-(4-methoxyanilino)quinazolin-6-yl]urea |
|---|---|
| PubChem CID | 44569611 |
| Molecular Formula | C22H17Cl2N5O2 |
| Molecular Weight | 454.32 g/mol |
| Exact Mass | 453.08 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-[4-(4-methoxyanilino)quinazolin-6-yl]urea |
| SMILES | COc1ccc(Nc2ncnc3ccc(NC(=O)Nc4ccc(Cl)c(Cl)c4)cc23)cc1 |
| InChI | InChI=1S/C22H17Cl2N5O2/c1-31-16-6-2-13(3-7-16)27-21-17-10-14(5-9-20(17)25-12-26-21)28-22(30)29-15-4-8-18(23)19(24)11-15/h2-12H,1H3,(H,25,26,27)(H2,28,29,30) |
| InChIKey | LSBUNKBYMQALDO-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 88.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.32 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |