C16H13N3O4 — CID 21002903
2-hydroxy-5-[(6-methoxyquinazolin-4-yl)amino]benzoic acid (PubChem CID 21002903) has the molecular formula C16H13N3O4 and a molecular weight of 311.30 g/mol. Its IUPAC name is 2-hydroxy-5-[(6-methoxyquinazolin-4-yl)amino]benzoic acid.
| Compound Name | 2-hydroxy-5-[(6-methoxyquinazolin-4-yl)amino]benzoic acid |
|---|---|
| PubChem CID | 21002903 |
| Molecular Formula | C16H13N3O4 |
| Molecular Weight | 311.30 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 2-hydroxy-5-[(6-methoxyquinazolin-4-yl)amino]benzoic acid |
| SMILES | COc1ccc2ncnc(Nc3ccc(O)c(C(=O)O)c3)c2c1 |
| InChI | InChI=1S/C16H13N3O4/c1-23-10-3-4-13-11(7-10)15(18-8-17-13)19-9-2-5-14(20)12(6-9)16(21)22/h2-8,20H,1H3,(H,21,22)(H,17,18,19) |
| InChIKey | LKIJTIXVSKTCMW-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 104.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.30 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|