C20H15N3O4 — CID 21004485
5-[[3-cyano-6-(4-methoxyphenyl)-2-pyridinyl]amino]-2-hydroxybenzoic acid (PubChem CID 21004485) has the molecular formula C20H15N3O4 and a molecular weight of 361.36 g/mol. Its IUPAC name is 5-[[3-cyano-6-(4-methoxyphenyl)-2-pyridinyl]amino]-2-hydroxybenzoic acid.
| Compound Name | 5-[[3-cyano-6-(4-methoxyphenyl)-2-pyridinyl]amino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 21004485 |
| Molecular Formula | C20H15N3O4 |
| Molecular Weight | 361.36 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 5-[[3-cyano-6-(4-methoxyphenyl)-2-pyridinyl]amino]-2-hydroxybenzoic acid |
| SMILES | COc1ccc(-c2ccc(C#N)c(Nc3ccc(O)c(C(=O)O)c3)n2)cc1 |
| InChI | InChI=1S/C20H15N3O4/c1-27-15-6-2-12(3-7-15)17-8-4-13(11-21)19(23-17)22-14-5-9-18(24)16(10-14)20(25)26/h2-10,24H,1H3,(H,22,23)(H,25,26) |
| InChIKey | VNWWTKOYDOJPIA-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 115.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.36 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|