C25H23N5O4 — CID 44569793
1-(3-acetylphenyl)-3-[4-(3,4-dimethoxyanilino)quinazolin-6-yl]urea (PubChem CID 44569793) has the molecular formula C25H23N5O4 and a molecular weight of 457.49 g/mol. Its IUPAC name is 1-(3-acetylphenyl)-3-[4-(3,4-dimethoxyanilino)quinazolin-6-yl]urea.
| Compound Name | 1-(3-acetylphenyl)-3-[4-(3,4-dimethoxyanilino)quinazolin-6-yl]urea |
|---|---|
| PubChem CID | 44569793 |
| Molecular Formula | C25H23N5O4 |
| Molecular Weight | 457.49 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | 1-(3-acetylphenyl)-3-[4-(3,4-dimethoxyanilino)quinazolin-6-yl]urea |
| SMILES | COc1ccc(Nc2ncnc3ccc(NC(=O)Nc4cccc(C(C)=O)c4)cc23)cc1OC |
| InChI | InChI=1S/C25H23N5O4/c1-15(31)16-5-4-6-17(11-16)29-25(32)30-18-7-9-21-20(12-18)24(27-14-26-21)28-19-8-10-22(33-2)23(13-19)34-3/h4-14H,1-3H3,(H,26,27,28)(H2,29,30,32) |
| InChIKey | PPNFQOCFASZNJI-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 114.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.49 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |