C25H21N3O3 — CID 127045208
(E)-3-(3,4-dimethoxyphenyl)-1-[3-(quinazolin-4-ylamino)phenyl]prop-2-en-1-one (PubChem CID 127045208) has the molecular formula C25H21N3O3 and a molecular weight of 411.46 g/mol. Its IUPAC name is (E)-3-(3,4-dimethoxyphenyl)-1-[3-(quinazolin-4-ylamino)phenyl]prop-2-en-1-one.
| Compound Name | (E)-3-(3,4-dimethoxyphenyl)-1-[3-(quinazolin-4-ylamino)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 127045208 |
| Molecular Formula | C25H21N3O3 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | (E)-3-(3,4-dimethoxyphenyl)-1-[3-(quinazolin-4-ylamino)phenyl]prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2cccc(Nc3ncnc4ccccc34)c2)cc1OC |
| InChI | InChI=1S/C25H21N3O3/c1-30-23-13-11-17(14-24(23)31-2)10-12-22(29)18-6-5-7-19(15-18)28-25-20-8-3-4-9-21(20)26-16-27-25/h3-16H,1-2H3,(H,26,27,28)/b12-10+ |
| InChIKey | OICZLPMHMDETMI-ZRDIBKRKSA-N |
| XLogP | 5.29 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|