C18H17N3O4 — CID 110434452
methyl 3-[(7,8-dimethoxyquinazolin-4-yl)amino]benzoate (PubChem CID 110434452) has the molecular formula C18H17N3O4 and a molecular weight of 339.35 g/mol. Its IUPAC name is methyl 3-[(7,8-dimethoxyquinazolin-4-yl)amino]benzoate.
| Compound Name | methyl 3-[(7,8-dimethoxyquinazolin-4-yl)amino]benzoate |
|---|---|
| PubChem CID | 110434452 |
| Molecular Formula | C18H17N3O4 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | methyl 3-[(7,8-dimethoxyquinazolin-4-yl)amino]benzoate |
| SMILES | COC(=O)c1cccc(Nc2ncnc3c(OC)c(OC)ccc23)c1 |
| InChI | InChI=1S/C18H17N3O4/c1-23-14-8-7-13-15(16(14)24-2)19-10-20-17(13)21-12-6-4-5-11(9-12)18(22)25-3/h4-10H,1-3H3,(H,19,20,21) |
| InChIKey | BMQDYWAJRLJZRY-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |