C17H16N4O5 — CID 24767191
6,7,8-trimethoxy-N-(3-nitrophenyl)quinazolin-4-amine (PubChem CID 24767191) has the molecular formula C17H16N4O5 and a molecular weight of 356.34 g/mol. Its IUPAC name is 6,7,8-trimethoxy-N-(3-nitrophenyl)quinazolin-4-amine.
| Compound Name | 6,7,8-trimethoxy-N-(3-nitrophenyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 24767191 |
| Molecular Formula | C17H16N4O5 |
| Molecular Weight | 356.34 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | 6,7,8-trimethoxy-N-(3-nitrophenyl)quinazolin-4-amine |
| SMILES | COc1cc2c(Nc3cccc([N+](=O)[O-])c3)ncnc2c(OC)c1OC |
| InChI | InChI=1S/C17H16N4O5/c1-24-13-8-12-14(16(26-3)15(13)25-2)18-9-19-17(12)20-10-5-4-6-11(7-10)21(22)23/h4-9H,1-3H3,(H,18,19,20) |
| InChIKey | LAUDUTKNJMRBBO-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 108.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.34 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|