C17H15BrClN3O3 — CID 24767185
N-(4-bromo-2-chlorophenyl)-6,7,8-trimethoxyquinazolin-4-amine (PubChem CID 24767185) has the molecular formula C17H15BrClN3O3 and a molecular weight of 424.68 g/mol. Its IUPAC name is N-(4-bromo-2-chlorophenyl)-6,7,8-trimethoxyquinazolin-4-amine.
| Compound Name | N-(4-bromo-2-chlorophenyl)-6,7,8-trimethoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 24767185 |
| Molecular Formula | C17H15BrClN3O3 |
| Molecular Weight | 424.68 g/mol |
| Exact Mass | 423.00 |
| IUPAC Name | N-(4-bromo-2-chlorophenyl)-6,7,8-trimethoxyquinazolin-4-amine |
| SMILES | COc1cc2c(Nc3ccc(Br)cc3Cl)ncnc2c(OC)c1OC |
| InChI | InChI=1S/C17H15BrClN3O3/c1-23-13-7-10-14(16(25-3)15(13)24-2)20-8-21-17(10)22-12-5-4-9(18)6-11(12)19/h4-8H,1-3H3,(H,20,21,22) |
| InChIKey | XLPDVSOEUVUCBT-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 65.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.68 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |