C18H18ClN3O3 — CID 11710213
N-[(4-chlorophenyl)methyl]-6,7,8-trimethoxyquinazolin-4-amine (PubChem CID 11710213) has the molecular formula C18H18ClN3O3 and a molecular weight of 359.81 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-6,7,8-trimethoxyquinazolin-4-amine.
| Compound Name | N-[(4-chlorophenyl)methyl]-6,7,8-trimethoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 11710213 |
| Molecular Formula | C18H18ClN3O3 |
| Molecular Weight | 359.81 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-6,7,8-trimethoxyquinazolin-4-amine |
| SMILES | COc1cc2c(NCc3ccc(Cl)cc3)ncnc2c(OC)c1OC |
| InChI | InChI=1S/C18H18ClN3O3/c1-23-14-8-13-15(17(25-3)16(14)24-2)21-10-22-18(13)20-9-11-4-6-12(19)7-5-11/h4-8,10H,9H2,1-3H3,(H,20,21,22) |
| InChIKey | LHBOTJAKRHYQRC-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 65.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.81 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |