C17H16FN3O2 — CID 1474879
N-[(4-fluorophenyl)methyl]-6,7-dimethoxyquinazolin-4-amine (PubChem CID 1474879) has the molecular formula C17H16FN3O2 and a molecular weight of 313.33 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-6,7-dimethoxyquinazolin-4-amine.
| Compound Name | N-[(4-fluorophenyl)methyl]-6,7-dimethoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 1474879 |
| Molecular Formula | C17H16FN3O2 |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-6,7-dimethoxyquinazolin-4-amine |
| SMILES | COc1cc2ncnc(NCc3ccc(F)cc3)c2cc1OC |
| InChI | InChI=1S/C17H16FN3O2/c1-22-15-7-13-14(8-16(15)23-2)20-10-21-17(13)19-9-11-3-5-12(18)6-4-11/h3-8,10H,9H2,1-2H3,(H,19,20,21) |
| InChIKey | LASSDHMCHFNZJI-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |