C34H32N6O7P+ — CID 155026757
bis[4-[[(6,7-dimethoxyquinazolin-4-yl)amino]methyl]phenoxy]-oxophosphanium (PubChem CID 155026757) has the molecular formula C34H32N6O7P+ and a molecular weight of 667.64 g/mol. Its IUPAC name is bis[4-[[(6,7-dimethoxyquinazolin-4-yl)amino]methyl]phenoxy]-oxophosphanium.
| Compound Name | bis[4-[[(6,7-dimethoxyquinazolin-4-yl)amino]methyl]phenoxy]-oxophosphanium |
|---|---|
| PubChem CID | 155026757 |
| Molecular Formula | C34H32N6O7P+ |
| Molecular Weight | 667.64 g/mol |
| Exact Mass | 667.21 |
| IUPAC Name | bis[4-[[(6,7-dimethoxyquinazolin-4-yl)amino]methyl]phenoxy]-oxophosphanium |
| SMILES | COc1cc2ncnc(NCc3ccc(O[P+](=O)Oc4ccc(CNc5ncnc6cc(OC)c(OC)cc56)cc4)cc3)c2cc1OC |
| InChI | InChI=1S/C34H32N6O7P/c1-42-29-13-25-27(15-31(29)44-3)37-19-39-33(25)35-17-21-5-9-23(10-6-21)46-48(41)47-24-11-7-22(8-12-24)18-36-34-26-14-30(43-2)32(45-4)16-28(26)38-20-40-34/h5-16,19-20H,17-18H2,1-4H3,(H,35,37,39)(H,36,38,40)/q+1 |
| InChIKey | NRTVPFQZGIJZMH-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 148.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.64 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|